C26H31NO4 — CID 108767571
methyl 2-[[[(E)-3-(4-ethoxyphenyl)-2-phenylprop-2-enoyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108767571) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl 2-[[[(E)-3-(4-ethoxyphenyl)-2-phenylprop-2-enoyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[[(E)-3-(4-ethoxyphenyl)-2-phenylprop-2-enoyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108767571 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | methyl 2-[[[(E)-3-(4-ethoxyphenyl)-2-phenylprop-2-enoyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | CCOc1ccc(/C=C(/C(=O)NCC2CCCCC2C(=O)OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO4/c1-3-31-22-15-13-19(14-16-22)17-24(20-9-5-4-6-10-20)25(28)27-18-21-11-7-8-12-23(21)26(29)30-2/h4-6,9-10,13-17,21,23H,3,7-8,11-12,18H2,1-2H3,(H,27,28)/b24-17+ |
| InChIKey | ZKWUWUPCRLTDAD-JJIBRWJFSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|