C22H23FN4O3S — CID 108775128
6-(4-fluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]pyridazin-3-amine (PubChem CID 108775128) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]pyridazin-3-amine.
| Compound Name | 6-(4-fluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 108775128 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-(4-fluorophenyl)-N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]pyridazin-3-amine |
| SMILES | O=S(=O)(c1ccc(CCNc2ccc(-c3ccc(F)cc3)nn2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H23FN4O3S/c23-19-5-3-18(4-6-19)21-9-10-22(26-25-21)24-12-11-17-1-7-20(8-2-17)31(28,29)27-13-15-30-16-14-27/h1-10H,11-16H2,(H,24,26) |
| InChIKey | ATGPUPHBSKXYRB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |