C20H23N5O4S2 — CID 108775593
4-[[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 108775593) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108775593 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CC1CCN(Cc2ccc3nc(Nc4ccc(S(N)(=O)=O)cc4[N+](=O)[O-])sc3c2)CC1 |
| InChI | InChI=1S/C20H23N5O4S2/c1-13-6-8-24(9-7-13)12-14-2-4-17-19(10-14)30-20(23-17)22-16-5-3-15(31(21,28)29)11-18(16)25(26)27/h2-5,10-11,13H,6-9,12H2,1H3,(H,22,23)(H2,21,28,29) |
| InChIKey | FXHIHTIDOTVQMJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|