C19H20N6O5S2 — CID 108777667
4-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 108777667) has the molecular formula C19H20N6O5S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108777667 |
| Molecular Formula | C19H20N6O5S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 4-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN1CCN(C(=O)c2ccc3nc(Nc4ccc(S(N)(=O)=O)cc4[N+](=O)[O-])sc3c2)CC1 |
| InChI | InChI=1S/C19H20N6O5S2/c1-23-6-8-24(9-7-23)18(26)12-2-4-15-17(10-12)31-19(22-15)21-14-5-3-13(32(20,29)30)11-16(14)25(27)28/h2-5,10-11H,6-9H2,1H3,(H,21,22)(H2,20,29,30) |
| InChIKey | CNBVGDSKDGWYFE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 151.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|