C20H21ClN4O4S2 — CID 108782357
4-chloro-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 108782357) has the molecular formula C20H21ClN4O4S2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 4-chloro-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108782357 |
| Molecular Formula | C20H21ClN4O4S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 4-chloro-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | CC1CCN(Cc2ccc3nc(NS(=O)(=O)c4ccc(Cl)c([N+](=O)[O-])c4)sc3c2)CC1 |
| InChI | InChI=1S/C20H21ClN4O4S2/c1-13-6-8-24(9-7-13)12-14-2-5-17-19(10-14)30-20(22-17)23-31(28,29)15-3-4-16(21)18(11-15)25(26)27/h2-5,10-11,13H,6-9,12H2,1H3,(H,22,23) |
| InChIKey | FSWISRJPEQEXDS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|