About 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile
4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile (PubChem CID 108776510) has the molecular formula C15H10ClN3O3
and a molecular weight of 315.72 g/mol. Its IUPAC name is 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile.
Molecular Properties
| Compound Name | 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile |
| PubChem CID | 108776510 |
| Molecular Formula | C15H10ClN3O3 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile |
| SMILES | CC(=O)c1c(C)oc(Nc2nc3cc(Cl)ccc3o2)c1C#N |
| InChI | InChI=1S/C15H10ClN3O3/c1-7(20)13-8(2)21-14(10(13)6-17)19-15-18-11-5-9(16)3-4-12(11)22-15/h3-5H,1-2H3,(H,18,19) |
| InChIKey | JSLAABSXASPWSM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile?
The IUPAC name of 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile (CID 108776510) is 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile.
What is the SMILES notation for 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile?
The canonical SMILES for 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile is CC(=O)c1c(C)oc(Nc2nc3cc(Cl)ccc3o2)c1C#N.
What is the InChIKey of 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile?
The InChIKey is JSLAABSXASPWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3O3/c1-7(20)13-8(2)21-14(10(13)6-17)19-15-18-11-5-9(16)3-4-12(11)22-15/h3-5H,1-2H3,(H,18,19).
What are the key properties of 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile?
4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile has a molecular weight of 315.72 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2-[(5-chloro-1,3-benzoxazol-2-yl)amino]-5-methylfuran-3-carbonitrile is sourced from PubChem (CID 108776510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).