C10H9ClN4O2S — CID 108778493
methyl 6-[[4-(chloromethyl)-1,3-thiazol-2-yl]amino]pyridazine-3-carboxylate (PubChem CID 108778493) has the molecular formula C10H9ClN4O2S and a molecular weight of 284.73 g/mol. Its IUPAC name is methyl 6-[[4-(chloromethyl)-1,3-thiazol-2-yl]amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[[4-(chloromethyl)-1,3-thiazol-2-yl]amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 108778493 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | methyl 6-[[4-(chloromethyl)-1,3-thiazol-2-yl]amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Nc2nc(CCl)cs2)nn1 |
| InChI | InChI=1S/C10H9ClN4O2S/c1-17-9(16)7-2-3-8(15-14-7)13-10-12-6(4-11)5-18-10/h2-3,5H,4H2,1H3,(H,12,13,15) |
| InChIKey | ZLSBDGUSKLXKER-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|