C21H21N5O2 — CID 108778548
5-(1,3-benzoxazol-2-ylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 108778548) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-ylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-(1,3-benzoxazol-2-ylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108778548 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 5-(1,3-benzoxazol-2-ylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnn(-c2ccccc2)c1Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C21H21N5O2/c1-3-25(4-2)20(27)16-14-22-26(15-10-6-5-7-11-15)19(16)24-21-23-17-12-8-9-13-18(17)28-21/h5-14H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | JORHECUWJUWQKO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |