C18H11ClN6O2S — CID 108779825
6-chloro-5-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]pyrimidin-4-amine (PubChem CID 108779825) has the molecular formula C18H11ClN6O2S and a molecular weight of 410.85 g/mol. Its IUPAC name is 6-chloro-5-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 108779825 |
| Molecular Formula | C18H11ClN6O2S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 6-chloro-5-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Nc1cccc(-c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C18H11ClN6O2S/c19-16-15(25(26)27)17(22-10-21-16)23-13-5-1-3-11(7-13)14-9-28-18(24-14)12-4-2-6-20-8-12/h1-10H,(H,21,22,23) |
| InChIKey | SFKOQTNQBSOFSB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|