C15H19NO6S — CID 108781394
4-[[(1R,2S)-2-carboxycyclohexyl]methylsulfamoyl]benzoic acid (PubChem CID 108781394) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-carboxycyclohexyl]methylsulfamoyl]benzoic acid.
| Compound Name | 4-[[(1R,2S)-2-carboxycyclohexyl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 108781394 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-[[(1R,2S)-2-carboxycyclohexyl]methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC[C@@H]2CCCC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO6S/c17-14(18)10-5-7-12(8-6-10)23(21,22)16-9-11-3-1-2-4-13(11)15(19)20/h5-8,11,13,16H,1-4,9H2,(H,17,18)(H,19,20)/t11-,13-/m0/s1 |
| InChIKey | ZEEKYZIAEYWJJE-AAEUAGOBSA-N |
| XLogP | 1.55 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |