C14H12ClN3O7S — CID 108782853
4-acetyl-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methylfuran-3-carboxamide (PubChem CID 108782853) has the molecular formula C14H12ClN3O7S and a molecular weight of 401.78 g/mol. Its IUPAC name is 4-acetyl-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methylfuran-3-carboxamide.
| Compound Name | 4-acetyl-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 108782853 |
| Molecular Formula | C14H12ClN3O7S |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 4-acetyl-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methylfuran-3-carboxamide |
| SMILES | CC(=O)c1c(C)oc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1C(N)=O |
| InChI | InChI=1S/C14H12ClN3O7S/c1-6(19)11-7(2)25-14(12(11)13(16)20)17-26(23,24)8-3-4-9(15)10(5-8)18(21)22/h3-5,17H,1-2H3,(H2,16,20) |
| InChIKey | HEOMNZCAFPFWGW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 162.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|