C14H22O — CID 10878320
(2E,5E)-3-ethyl-5,9-dimethyldeca-2,5,9-trien-4-one (PubChem CID 10878320) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-5,9-dimethyldeca-2,5,9-trien-4-one.
| Compound Name | (2E,5E)-3-ethyl-5,9-dimethyldeca-2,5,9-trien-4-one |
|---|---|
| PubChem CID | 10878320 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2E,5E)-3-ethyl-5,9-dimethyldeca-2,5,9-trien-4-one |
| SMILES | C=C(C)CC/C=C(\C)C(=O)/C(=C/C)CC |
| InChI | InChI=1S/C14H22O/c1-6-13(7-2)14(15)12(5)10-8-9-11(3)4/h6,10H,3,7-9H2,1-2,4-5H3/b12-10+,13-6+ |
| InChIKey | FNQAQYQTNSJYKP-CZKXXPGYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|