C17H15ClN2O6S — CID 108783241
4-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitrobenzenesulfonamide (PubChem CID 108783241) has the molecular formula C17H15ClN2O6S and a molecular weight of 410.84 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108783241 |
| Molecular Formula | C17H15ClN2O6S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitrobenzenesulfonamide |
| SMILES | CC1(C)CC(=O)c2cc(NS(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)ccc2O1 |
| InChI | InChI=1S/C17H15ClN2O6S/c1-17(2)9-15(21)12-7-10(3-6-16(12)26-17)19-27(24,25)11-4-5-13(18)14(8-11)20(22)23/h3-8,19H,9H2,1-2H3 |
| InChIKey | WAVAPIRHZMIXRJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|