C19H21NO4S — CID 108783245
N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2,4-dimethylbenzenesulfonamide (PubChem CID 108783245) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 108783245 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)CC(C)(C)O3)c(C)c1 |
| InChI | InChI=1S/C19H21NO4S/c1-12-5-8-18(13(2)9-12)25(22,23)20-14-6-7-17-15(10-14)16(21)11-19(3,4)24-17/h5-10,20H,11H2,1-4H3 |
| InChIKey | LGKWBOUZCNCWQX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |