C19H19ClN4O3S2 — CID 108783259
N-[4-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 108783259) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-[4-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 108783259 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-[4-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3nc4ccc(Cl)cc4s3)CC2)cc1 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-13(25)21-15-3-5-16(6-4-15)29(26,27)24-10-8-23(9-11-24)19-22-17-7-2-14(20)12-18(17)28-19/h2-7,12H,8-11H2,1H3,(H,21,25) |
| InChIKey | RRHZVQFLPHSTLE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |