C18H18FN3O3S2 — CID 16937352
6-fluoro-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole (PubChem CID 16937352) has the molecular formula C18H18FN3O3S2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 6-fluoro-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-fluoro-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 16937352 |
| Molecular Formula | C18H18FN3O3S2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 6-fluoro-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3nc4ccc(F)cc4s3)CC2)cc1 |
| InChI | InChI=1S/C18H18FN3O3S2/c1-25-14-3-5-15(6-4-14)27(23,24)22-10-8-21(9-11-22)18-20-16-7-2-13(19)12-17(16)26-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | VTOWWNYHPVDIIJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |