C17H13ClN4O2 — CID 108786175
2-(4-chlorophenyl)-6-oxo-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 108786175) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-oxo-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-6-oxo-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 108786175 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(4-chlorophenyl)-6-oxo-N-(pyridin-3-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H13ClN4O2/c18-13-5-3-12(4-6-13)15-20-10-14(17(24)22-15)16(23)21-9-11-2-1-7-19-8-11/h1-8,10H,9H2,(H,21,23)(H,20,22,24) |
| InChIKey | MRPPMJOLYXFTTO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |