C16H16ClN3O4 — CID 108799274
2-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-2-methylbutanoic acid (PubChem CID 108799274) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 108799274 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)c1cnc(-c2ccc(Cl)cc2)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C16H16ClN3O4/c1-3-16(2,15(23)24)20-14(22)11-8-18-12(19-13(11)21)9-4-6-10(17)7-5-9/h4-8H,3H2,1-2H3,(H,20,22)(H,23,24)(H,18,19,21) |
| InChIKey | QVGYIJYLXHZWOO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |