C18H12ClN3O5 — CID 108799385
4-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-3-hydroxybenzoic acid (PubChem CID 108799385) has the molecular formula C18H12ClN3O5 and a molecular weight of 385.76 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108799385 |
| Molecular Formula | C18H12ClN3O5 |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carbonyl]amino]-3-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cnc(-c3ccc(Cl)cc3)[nH]c2=O)c(O)c1 |
| InChI | InChI=1S/C18H12ClN3O5/c19-11-4-1-9(2-5-11)15-20-8-12(17(25)22-15)16(24)21-13-6-3-10(18(26)27)7-14(13)23/h1-8,23H,(H,21,24)(H,26,27)(H,20,22,25) |
| InChIKey | KOTTZNFMPHMYGR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|