C17H9ClF3N3O2 — CID 108799261
2-(4-chlorophenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-5-carboxamide (PubChem CID 108799261) has the molecular formula C17H9ClF3N3O2 and a molecular weight of 379.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 108799261 |
| Molecular Formula | C17H9ClF3N3O2 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-(4-chlorophenyl)-6-oxo-N-(2,3,4-trifluorophenyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H9ClF3N3O2/c18-9-3-1-8(2-4-9)15-22-7-10(17(26)24-15)16(25)23-12-6-5-11(19)13(20)14(12)21/h1-7H,(H,23,25)(H,22,24,26) |
| InChIKey | SMYIDQBGGGQZFE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|