C19H21N3O4 — CID 108788123
N-[2-(4-methoxyphenoxy)ethyl]-4-methyl-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide (PubChem CID 108788123) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-4-methyl-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-4-methyl-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 108788123 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-4-methyl-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2(C)CC(=O)N=C3C=CC=CN32)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-19(13-17(23)21-16-5-3-4-11-22(16)19)18(24)20-10-12-26-15-8-6-14(25-2)7-9-15/h3-9,11H,10,12-13H2,1-2H3,(H,20,24) |
| InChIKey | LQRZOWBSHOBFPE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|