C19H21N5O3 — CID 51499025
(4S)-4,8-dimethyl-2-oxo-N-[2-(pyridine-2-carbonylamino)ethyl]-3H-pyrido[1,2-a]pyrimidine-4-carboxamide (PubChem CID 51499025) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is (4S)-4,8-dimethyl-2-oxo-N-[2-(pyridine-2-carbonylamino)ethyl]-3H-pyrido[1,2-a]pyrimidine-4-carboxamide.
| Compound Name | (4S)-4,8-dimethyl-2-oxo-N-[2-(pyridine-2-carbonylamino)ethyl]-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 51499025 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (4S)-4,8-dimethyl-2-oxo-N-[2-(pyridine-2-carbonylamino)ethyl]-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
| SMILES | CC1=CC2=NC(=O)C[C@@](C)(C(=O)NCCNC(=O)c3ccccn3)N2C=C1 |
| InChI | InChI=1S/C19H21N5O3/c1-13-6-10-24-15(11-13)23-16(25)12-19(24,2)18(27)22-9-8-21-17(26)14-5-3-4-7-20-14/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,26)(H,22,27)/t19-/m0/s1 |
| InChIKey | DBRUXLDMHLJKKS-IBGZPJMESA-N |
| XLogP | 0.79 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|