C24H27N3O3 — CID 108790644
2-methyl-3-oxo-5,6-diphenyl-N-(3-propan-2-yloxypropyl)pyridazine-4-carboxamide (PubChem CID 108790644) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-methyl-3-oxo-5,6-diphenyl-N-(3-propan-2-yloxypropyl)pyridazine-4-carboxamide.
| Compound Name | 2-methyl-3-oxo-5,6-diphenyl-N-(3-propan-2-yloxypropyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790644 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-methyl-3-oxo-5,6-diphenyl-N-(3-propan-2-yloxypropyl)pyridazine-4-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1c(-c2ccccc2)c(-c2ccccc2)nn(C)c1=O |
| InChI | InChI=1S/C24H27N3O3/c1-17(2)30-16-10-15-25-23(28)21-20(18-11-6-4-7-12-18)22(26-27(3)24(21)29)19-13-8-5-9-14-19/h4-9,11-14,17H,10,15-16H2,1-3H3,(H,25,28) |
| InChIKey | HGXKHUNAKWSJFB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|