C26H28N4O3 — CID 108790708
2-ethyl-3-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790708) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-ethyl-3-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | 2-ethyl-3-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790708 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-ethyl-3-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | CCn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)NCCCN2CCCC2=O)c1=O |
| InChI | InChI=1S/C26H28N4O3/c1-2-30-26(33)23(25(32)27-16-10-18-29-17-9-15-21(29)31)22(19-11-5-3-6-12-19)24(28-30)20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3,(H,27,32) |
| InChIKey | BWWQTXXAFQHUKK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|