C15H16N2O6S — CID 108791296
2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-3-sulfanylpropanoic acid (PubChem CID 108791296) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 108791296 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(NC(CS)C(=O)O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C15H16N2O6S/c18-13-3-8(14(19)16-10(6-24)15(20)21)5-17(13)9-1-2-11-12(4-9)23-7-22-11/h1-2,4,8,10,24H,3,5-7H2,(H,16,19)(H,20,21) |
| InChIKey | RAGUPKMALGOUFC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|