C11H18N2O4S — CID 108792200
2-[(1-acetylpiperidine-4-carbonyl)amino]-3-sulfanylpropanoic acid (PubChem CID 108792200) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[(1-acetylpiperidine-4-carbonyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(1-acetylpiperidine-4-carbonyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 108792200 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[(1-acetylpiperidine-4-carbonyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N1CCC(C(=O)NC(CS)C(=O)O)CC1 |
| InChI | InChI=1S/C11H18N2O4S/c1-7(14)13-4-2-8(3-5-13)10(15)12-9(6-18)11(16)17/h8-9,18H,2-6H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | CDSPIJDHTIVQDE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|