C18H17N5O3S — CID 108793434
prop-2-enyl 4-methyl-2-[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 108793434) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-2-[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 108793434 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | prop-2-enyl 4-methyl-2-[(5-methyl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)c2cnn(-c3ccccn3)c2C)nc1C |
| InChI | InChI=1S/C18H17N5O3S/c1-4-9-26-17(25)15-11(2)21-18(27-15)22-16(24)13-10-20-23(12(13)3)14-7-5-6-8-19-14/h4-8,10H,1,9H2,2-3H3,(H,21,22,24) |
| InChIKey | TWZVMEGVHABEHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|