C17H24O — CID 10879359
[(2E)-2,7-dimethylocta-2,7-dienoxy]methylbenzene (PubChem CID 10879359) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is [(2E)-2,7-dimethylocta-2,7-dienoxy]methylbenzene.
| Compound Name | [(2E)-2,7-dimethylocta-2,7-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 10879359 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | [(2E)-2,7-dimethylocta-2,7-dienoxy]methylbenzene |
| SMILES | C=C(C)CCC/C=C(\C)COCc1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-15(2)9-7-8-10-16(3)13-18-14-17-11-5-4-6-12-17/h4-6,10-12H,1,7-9,13-14H2,2-3H3/b16-10+ |
| InChIKey | FNNSFBKPXNERRF-MHWRWJLKSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|