C16H20N2O2 — CID 108794252
N-cyclopentyl-2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetamide (PubChem CID 108794252) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-cyclopentyl-2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 108794252 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-cyclopentyl-2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetamide |
| SMILES | Cc1cc(C)c2c(CC(=O)NC3CCCC3)noc2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-10-7-11(2)16-13(18-20-14(16)8-10)9-15(19)17-12-5-3-4-6-12/h7-8,12H,3-6,9H2,1-2H3,(H,17,19) |
| InChIKey | SLENHXPKYGDKKB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |