C25H18N2O4 — CID 108794350
2-(4,6-dimethyl-1,2-benzoxazol-3-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 108794350) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,2-benzoxazol-3-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-(4,6-dimethyl-1,2-benzoxazol-3-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 108794350 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-(4,6-dimethyl-1,2-benzoxazol-3-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | Cc1cc(C)c2c(CC(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)noc2c1 |
| InChI | InChI=1S/C25H18N2O4/c1-13-10-14(2)22-19(27-31-20(22)11-13)12-21(28)26-18-9-5-8-17-23(18)25(30)16-7-4-3-6-15(16)24(17)29/h3-11H,12H2,1-2H3,(H,26,28) |
| InChIKey | CUMUORMFVBGDHU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|