C28H30N4O — CID 108797289
N-(1-adamantyl)-3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzamide (PubChem CID 108797289) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(1-adamantyl)-3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 108797289 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-(1-adamantyl)-3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzamide |
| SMILES | Cc1nc(Nc2cccc(C(=O)NC34CC5CC(CC(C5)C3)C4)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H30N4O/c1-18-29-25(22-6-3-2-4-7-22)14-26(30-18)31-24-9-5-8-23(13-24)27(33)32-28-15-19-10-20(16-28)12-21(11-19)17-28/h2-9,13-14,19-21H,10-12,15-17H2,1H3,(H,32,33)(H,29,30,31) |
| InChIKey | IHJWEDCDUWWGKL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |