C15H18O5 — CID 10880414
ethyl (2Z)-2-[(3Z)-2-ethyl-9-oxo-5,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate (PubChem CID 10880414) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3Z)-2-ethyl-9-oxo-5,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3Z)-2-ethyl-9-oxo-5,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate |
|---|---|
| PubChem CID | 10880414 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethyl (2Z)-2-[(3Z)-2-ethyl-9-oxo-5,6-dihydro-2H-furo[3,4-b]oxocin-7-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\OC(=O)C2=C1CC/C=C\C(CC)O2 |
| InChI | InChI=1S/C15H18O5/c1-3-10-7-5-6-8-11-12(9-13(16)18-4-2)20-15(17)14(11)19-10/h5,7,9-10H,3-4,6,8H2,1-2H3/b7-5-,12-9- |
| InChIKey | XJKAWCDDOSGXBV-ZSIOEQIDSA-N |
| XLogP | 2.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|