C12H14O5 — CID 102177847
ethyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate (PubChem CID 102177847) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is ethyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 102177847 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | ethyl (Z,4Z)-4-(3,4-dimethyl-5-oxofuran-2-ylidene)-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)/C=C(O)/C=C1\OC(=O)C(C)=C1C |
| InChI | InChI=1S/C12H14O5/c1-4-16-11(14)6-9(13)5-10-7(2)8(3)12(15)17-10/h5-6,13H,4H2,1-3H3/b9-6-,10-5- |
| InChIKey | FCURFIMSZAMXKA-YXSNPGODSA-N |
| XLogP | 1.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|