C17H14N6OS2 — CID 108810052
2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide (PubChem CID 108810052) has the molecular formula C17H14N6OS2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide.
| Compound Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide |
|---|---|
| PubChem CID | 108810052 |
| Molecular Formula | C17H14N6OS2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide |
| SMILES | O=C(CC1=CSC2=NCCN12)Nc1nc2scc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C17H14N6OS2/c24-14(8-12-9-25-16-18-6-7-22(12)16)19-15-20-17-23(21-15)13(10-26-17)11-4-2-1-3-5-11/h1-5,9-10H,6-8H2,(H,19,21,24) |
| InChIKey | OEYGAJCSCQOMQZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |