C26H21N3O3S — CID 108811342
4-(6-methyl-4-oxochromen-2-yl)-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide (PubChem CID 108811342) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-(6-methyl-4-oxochromen-2-yl)-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide.
| Compound Name | 4-(6-methyl-4-oxochromen-2-yl)-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 108811342 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-(6-methyl-4-oxochromen-2-yl)-N-[2-(4-thiophen-2-yl-1H-imidazol-5-yl)ethyl]benzamide |
| SMILES | Cc1ccc2oc(-c3ccc(C(=O)NCCc4[nH]cnc4-c4cccs4)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H21N3O3S/c1-16-4-9-22-19(13-16)21(30)14-23(32-22)17-5-7-18(8-6-17)26(31)27-11-10-20-25(29-15-28-20)24-3-2-12-33-24/h2-9,12-15H,10-11H2,1H3,(H,27,31)(H,28,29) |
| InChIKey | FBTCIDZBDLQJAP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |