C26H21NO4 — CID 108811358
N-(3,4-dihydro-2H-chromen-4-yl)-4-(6-methyl-4-oxochromen-2-yl)benzamide (PubChem CID 108811358) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-4-(6-methyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(6-methyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108811358 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(6-methyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1ccc2oc(-c3ccc(C(=O)NC4CCOc5ccccc54)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H21NO4/c1-16-6-11-24-20(14-16)22(28)15-25(31-24)17-7-9-18(10-8-17)26(29)27-21-12-13-30-23-5-3-2-4-19(21)23/h2-11,14-15,21H,12-13H2,1H3,(H,27,29) |
| InChIKey | UTMMUTSJGBHDFV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |