C11H8N4O2 — CID 108811788
1-(2-cyanophenyl)-3-(1,2-oxazol-3-yl)urea (PubChem CID 108811788) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-cyanophenyl)-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108811788 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(2-cyanophenyl)-3-(1,2-oxazol-3-yl)urea |
| SMILES | N#Cc1ccccc1NC(=O)Nc1ccon1 |
| InChI | InChI=1S/C11H8N4O2/c12-7-8-3-1-2-4-9(8)13-11(16)14-10-5-6-17-15-10/h1-6H,(H2,13,14,15,16) |
| InChIKey | RTVZMDQUSUMVLP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |