C14H15FN4O2 — CID 108814201
4-(2-fluorophenyl)-N-(1,2-oxazol-5-yl)piperazine-1-carboxamide (PubChem CID 108814201) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-(1,2-oxazol-5-yl)piperazine-1-carboxamide.
| Compound Name | 4-(2-fluorophenyl)-N-(1,2-oxazol-5-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108814201 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-(2-fluorophenyl)-N-(1,2-oxazol-5-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccno1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H15FN4O2/c15-11-3-1-2-4-12(11)18-7-9-19(10-8-18)14(20)17-13-5-6-16-21-13/h1-6H,7-10H2,(H,17,20) |
| InChIKey | XRQJDFWUPBAKIC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |