C16H13BrN4O — CID 108814930
(Z)-N-(4-bromophenyl)-2-cyano-3-(pyridin-2-ylmethylamino)prop-2-enamide (PubChem CID 108814930) has the molecular formula C16H13BrN4O and a molecular weight of 357.21 g/mol. Its IUPAC name is (Z)-N-(4-bromophenyl)-2-cyano-3-(pyridin-2-ylmethylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-bromophenyl)-2-cyano-3-(pyridin-2-ylmethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108814930 |
| Molecular Formula | C16H13BrN4O |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (Z)-N-(4-bromophenyl)-2-cyano-3-(pyridin-2-ylmethylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccccn1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrN4O/c17-13-4-6-14(7-5-13)21-16(22)12(9-18)10-19-11-15-3-1-2-8-20-15/h1-8,10,19H,11H2,(H,21,22)/b12-10- |
| InChIKey | DNDQZRCMRIFFLQ-BENRWUELSA-N |
| XLogP | 2.98 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|