C16H24N4O4S — CID 108815522
(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 108815522) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108815522 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | CN(/C=C(/C#N)C(=O)NCCCN1CCCC1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N4O4S/c1-19(14-5-9-25(23,24)12-14)11-13(10-17)16(22)18-6-3-8-20-7-2-4-15(20)21/h11,14H,2-9,12H2,1H3,(H,18,22)/b13-11- |
| InChIKey | GWIXRSNXXIKBBK-QBFSEMIESA-N |
| XLogP | -0.36 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|