C18H22FN3O2 — CID 108830856
(Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[2-(4-fluorophenyl)ethylamino]prop-2-enenitrile (PubChem CID 108830856) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[2-(4-fluorophenyl)ethylamino]prop-2-enenitrile.
| Compound Name | (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[2-(4-fluorophenyl)ethylamino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108830856 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[2-(4-fluorophenyl)ethylamino]prop-2-enenitrile |
| SMILES | CC1CN(C(=O)/C(C#N)=C\NCCc2ccc(F)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H22FN3O2/c1-13-11-22(12-14(2)24-13)18(23)16(9-20)10-21-8-7-15-3-5-17(19)6-4-15/h3-6,10,13-14,21H,7-8,11-12H2,1-2H3/b16-10- |
| InChIKey | UOAFQPMCYPINKE-YBEGLDIGSA-N |
| XLogP | 2.00 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|