C17H19N3O4 — CID 108830599
4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 108830599) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108830599 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | CC1CN(C(=O)/C(C#N)=C\Nc2ccc(C(=O)O)cc2)CC(C)O1 |
| InChI | InChI=1S/C17H19N3O4/c1-11-9-20(10-12(2)24-11)16(21)14(7-18)8-19-15-5-3-13(4-6-15)17(22)23/h3-6,8,11-12,19H,9-10H2,1-2H3,(H,22,23)/b14-8- |
| InChIKey | SZIOUDHHIZNBCV-ZSOIEALJSA-N |
| XLogP | 1.84 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|