C23H25N3O2 — CID 108830645
(Z)-3-(benzhydrylamino)-2-(2,6-dimethylmorpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 108830645) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (Z)-3-(benzhydrylamino)-2-(2,6-dimethylmorpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(benzhydrylamino)-2-(2,6-dimethylmorpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108830645 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (Z)-3-(benzhydrylamino)-2-(2,6-dimethylmorpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | CC1CN(C(=O)/C(C#N)=C\NC(c2ccccc2)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C23H25N3O2/c1-17-15-26(16-18(2)28-17)23(27)21(13-24)14-25-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,14,17-18,22,25H,15-16H2,1-2H3/b21-14- |
| InChIKey | ZNNAEIIFVFNDTF-STZFKDTASA-N |
| XLogP | 3.41 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|