C18H21N3O4 — CID 108830739
2-[4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]phenyl]acetic acid (PubChem CID 108830739) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 108830739 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[4-[[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]amino]phenyl]acetic acid |
| SMILES | CC1CN(C(=O)/C(C#N)=C\Nc2ccc(CC(=O)O)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H21N3O4/c1-12-10-21(11-13(2)25-12)18(24)15(8-19)9-20-16-5-3-14(4-6-16)7-17(22)23/h3-6,9,12-13,20H,7,10-11H2,1-2H3,(H,22,23)/b15-9- |
| InChIKey | NBGOPTJBVZBRJJ-DHDCSXOGSA-N |
| XLogP | 1.77 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|