C18H20N4O4 — CID 108841138
2-[4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]phenyl]acetic acid (PubChem CID 108841138) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 108841138 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]phenyl]acetic acid |
| SMILES | CC(=O)N1CCN(C(=O)/C(C#N)=C\Nc2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C18H20N4O4/c1-13(23)21-6-8-22(9-7-21)18(26)15(11-19)12-20-16-4-2-14(3-5-16)10-17(24)25/h2-5,12,20H,6-10H2,1H3,(H,24,25)/b15-12- |
| InChIKey | SNKJZLZSZNSNRX-QINSGFPZSA-N |
| XLogP | 0.82 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|