C16H18N4O5S — CID 108840987
4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzenesulfonic acid (PubChem CID 108840987) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108840987 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 4-[[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
| SMILES | CC(=O)N1CCN(C(=O)/C(C#N)=C\Nc2ccc(S(=O)(=O)O)cc2)CC1 |
| InChI | InChI=1S/C16H18N4O5S/c1-12(21)19-6-8-20(9-7-19)16(22)13(10-17)11-18-14-2-4-15(5-3-14)26(23,24)25/h2-5,11,18H,6-9H2,1H3,(H,23,24,25)/b13-11- |
| InChIKey | XLBPVVUMSKDRMQ-QBFSEMIESA-N |
| XLogP | 0.44 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|