C16H28Br2 — CID 10883405
(3S,4E,7R)-1,1-dibromo-3,5,7-trimethyltrideca-1,4-diene (PubChem CID 10883405) has the molecular formula C16H28Br2 and a molecular weight of 380.21 g/mol. Its IUPAC name is (3S,4E,7R)-1,1-dibromo-3,5,7-trimethyltrideca-1,4-diene.
| Compound Name | (3S,4E,7R)-1,1-dibromo-3,5,7-trimethyltrideca-1,4-diene |
|---|---|
| PubChem CID | 10883405 |
| Molecular Formula | C16H28Br2 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (3S,4E,7R)-1,1-dibromo-3,5,7-trimethyltrideca-1,4-diene |
| SMILES | CCCCCC[C@@H](C)C/C(C)=C/[C@H](C)C=C(Br)Br |
| InChI | InChI=1S/C16H28Br2/c1-5-6-7-8-9-13(2)10-14(3)11-15(4)12-16(17)18/h11-13,15H,5-10H2,1-4H3/b14-11+/t13-,15+/m1/s1 |
| InChIKey | UEDYWIYMJPSGLY-RFHWTAPTSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|