C22H32N4O4S — CID 108837251
(Z)-N-(3-butoxypropyl)-2-cyano-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-enamide (PubChem CID 108837251) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is (Z)-N-(3-butoxypropyl)-2-cyano-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108837251 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]prop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C22H32N4O4S/c1-3-4-15-30-16-5-10-24-22(27)20(17-23)18-25-11-13-26(14-12-25)31(28,29)21-8-6-19(2)7-9-21/h6-9,18H,3-5,10-16H2,1-2H3,(H,24,27)/b20-18- |
| InChIKey | USXSBFADTNTWGT-ZZEZOPTASA-N |
| XLogP | 2.03 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|