C15H25N3O3 — CID 108836963
(Z)-N-(3-butoxypropyl)-2-cyano-3-morpholin-4-ylprop-2-enamide (PubChem CID 108836963) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (Z)-N-(3-butoxypropyl)-2-cyano-3-morpholin-4-ylprop-2-enamide.
| Compound Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 108836963 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-morpholin-4-ylprop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\N1CCOCC1 |
| InChI | InChI=1S/C15H25N3O3/c1-2-3-8-20-9-4-5-17-15(19)14(12-16)13-18-6-10-21-11-7-18/h13H,2-11H2,1H3,(H,17,19)/b14-13- |
| InChIKey | XVOZLKDVKHUNEJ-YPKPFQOOSA-N |
| XLogP | 1.05 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|