C17H28N4O4 — CID 108837252
methyl 4-[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108837252) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is methyl 4-[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108837252 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl 4-[(Z)-3-(3-butoxypropylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\N1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H28N4O4/c1-3-4-11-25-12-5-6-19-16(22)15(13-18)14-20-7-9-21(10-8-20)17(23)24-2/h14H,3-12H2,1-2H3,(H,19,22)/b15-14- |
| InChIKey | VBEQENHUJLTZRO-PFONDFGASA-N |
| XLogP | 1.10 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|